C31H39N3O8 — CID 56620696
benzyl 4-[(4S)-5-ethoxy-5-oxo-4-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]pentyl]piperidine-1-carboxylate (PubChem CID 56620696) has the molecular formula C31H39N3O8 and a molecular weight of 581.67 g/mol. Its IUPAC name is benzyl 4-[(4S)-5-ethoxy-5-oxo-4-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]pentyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(4S)-5-ethoxy-5-oxo-4-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]pentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56620696 |
| Molecular Formula | C31H39N3O8 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | benzyl 4-[(4S)-5-ethoxy-5-oxo-4-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]pentyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)[C@H](CCCC1CCN(C(=O)OCc2ccccc2)CC1)NOC(=O)CN1C(=O)CCOc2ccccc21 |
| InChI | InChI=1S/C31H39N3O8/c1-2-39-30(37)25(32-42-29(36)21-34-26-13-6-7-14-27(26)40-20-17-28(34)35)12-8-11-23-15-18-33(19-16-23)31(38)41-22-24-9-4-3-5-10-24/h3-7,9-10,13-14,23,25,32H,2,8,11-12,15-22H2,1H3/t25-/m0/s1 |
| InChIKey | WGFZBKZHAMKGAC-VWLOTQADSA-N |
| XLogP | 4.00 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|