C23H26N2O6 — CID 18599696
ethyl (2S)-2-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]-4-phenylbutanoate (PubChem CID 18599696) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 18599696 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl (2S)-2-[[2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetyl]oxyamino]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)NOC(=O)CN1C(=O)CCOc2ccccc21 |
| InChI | InChI=1S/C23H26N2O6/c1-2-29-23(28)18(13-12-17-8-4-3-5-9-17)24-31-22(27)16-25-19-10-6-7-11-20(19)30-15-14-21(25)26/h3-11,18,24H,2,12-16H2,1H3/t18-/m0/s1 |
| InChIKey | OACHRKMPNQXQJE-SFHVURJKSA-N |
| XLogP | 2.41 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|