C27H32N2O5 — CID 88712292
2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(4-oxo-3-phenyl-1-propoxybut-3-enyl)amino]propanoyl]amino]acetic acid (PubChem CID 88712292) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(4-oxo-3-phenyl-1-propoxybut-3-enyl)amino]propanoyl]amino]acetic acid.
| Compound Name | 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(4-oxo-3-phenyl-1-propoxybut-3-enyl)amino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 88712292 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-[2,3-dihydro-1H-inden-2-yl-[(2S)-2-[(4-oxo-3-phenyl-1-propoxybut-3-enyl)amino]propanoyl]amino]acetic acid |
| SMILES | CCCOC(CC(=C=O)c1ccccc1)N[C@@H](C)C(=O)N(CC(=O)O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C27H32N2O5/c1-3-13-34-25(16-23(18-30)20-9-5-4-6-10-20)28-19(2)27(33)29(17-26(31)32)24-14-21-11-7-8-12-22(21)15-24/h4-12,19,24-25,28H,3,13-17H2,1-2H3,(H,31,32)/t19-,25?/m0/s1 |
| InChIKey | PRLNLRGNKFBWTO-UBDBMELISA-N |
| XLogP | 3.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|