C32H43N3O4 — CID 88711500
tert-butyl 2-[[(2S)-2-[[1-(butylamino)-4-oxo-3-phenylbut-3-enyl]amino]propanoyl]-(2,3-dihydro-1H-inden-2-yl)amino]acetate (PubChem CID 88711500) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-2-[[1-(butylamino)-4-oxo-3-phenylbut-3-enyl]amino]propanoyl]-(2,3-dihydro-1H-inden-2-yl)amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-2-[[1-(butylamino)-4-oxo-3-phenylbut-3-enyl]amino]propanoyl]-(2,3-dihydro-1H-inden-2-yl)amino]acetate |
|---|---|
| PubChem CID | 88711500 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | tert-butyl 2-[[(2S)-2-[[1-(butylamino)-4-oxo-3-phenylbut-3-enyl]amino]propanoyl]-(2,3-dihydro-1H-inden-2-yl)amino]acetate |
| SMILES | CCCCNC(CC(=C=O)c1ccccc1)N[C@@H](C)C(=O)N(CC(=O)OC(C)(C)C)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C32H43N3O4/c1-6-7-17-33-29(20-27(22-36)24-13-9-8-10-14-24)34-23(2)31(38)35(21-30(37)39-32(3,4)5)28-18-25-15-11-12-16-26(25)19-28/h8-16,23,28-29,33-34H,6-7,17-21H2,1-5H3/t23-,29?/m0/s1 |
| InChIKey | RTMKGTKLXQZHNS-QASNXKAYSA-N |
| XLogP | 4.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|