C26H35N2O3+ — CID 91807346
(2R)-2-methyl-1-[3-[4-(5-phenylpentoxy)phenyl]propanoyl]pyrrolidin-1-ium-1-carboxamide (PubChem CID 91807346) has the molecular formula C26H35N2O3+ and a molecular weight of 423.58 g/mol. Its IUPAC name is (2R)-2-methyl-1-[3-[4-(5-phenylpentoxy)phenyl]propanoyl]pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-2-methyl-1-[3-[4-(5-phenylpentoxy)phenyl]propanoyl]pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91807346 |
| Molecular Formula | C26H35N2O3+ |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (2R)-2-methyl-1-[3-[4-(5-phenylpentoxy)phenyl]propanoyl]pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(N)=O)C(=O)CCc1ccc(OCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-21-9-8-19-28(21,26(27)30)25(29)18-15-23-13-16-24(17-14-23)31-20-7-3-6-12-22-10-4-2-5-11-22/h2,4-5,10-11,13-14,16-17,21H,3,6-9,12,15,18-20H2,1H3,(H-,27,30)/p+1/t21-,28?/m1/s1 |
| InChIKey | UOOQPTPYCBFNIW-IHKRANBOSA-O |
| XLogP | 5.02 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|