C27H32N3O2+ — CID 69061791
(2R)-2-methyl-1-(5-phenylpentanoyl)-N-(2-pyrrol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 69061791) has the molecular formula C27H32N3O2+ and a molecular weight of 430.57 g/mol. Its IUPAC name is (2R)-2-methyl-1-(5-phenylpentanoyl)-N-(2-pyrrol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-2-methyl-1-(5-phenylpentanoyl)-N-(2-pyrrol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 69061791 |
| Molecular Formula | C27H32N3O2+ |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (2R)-2-methyl-1-(5-phenylpentanoyl)-N-(2-pyrrol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)CCCCc1ccccc1)C(=O)Nc1ccccc1-n1cccc1 |
| InChI | InChI=1S/C27H31N3O2/c1-22-12-11-21-30(22,26(31)18-8-5-15-23-13-3-2-4-14-23)27(32)28-24-16-6-7-17-25(24)29-19-9-10-20-29/h2-4,6-7,9-10,13-14,16-17,19-20,22H,5,8,11-12,15,18,21H2,1H3/p+1/t22-,30?/m1/s1 |
| InChIKey | LPRWUOUFZADKCF-VWRCBCJMSA-O |
| XLogP | 5.95 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|