C17H22NO4+ — CID 57163498
methyl (2R)-2-methyl-1-(4-oxo-4-phenylbutanoyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 57163498) has the molecular formula C17H22NO4+ and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl (2R)-2-methyl-1-(4-oxo-4-phenylbutanoyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | methyl (2R)-2-methyl-1-(4-oxo-4-phenylbutanoyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57163498 |
| Molecular Formula | C17H22NO4+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl (2R)-2-methyl-1-(4-oxo-4-phenylbutanoyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | COC(=O)[N+]1(C(=O)CCC(=O)c2ccccc2)CCC[C@H]1C |
| InChI | InChI=1S/C17H22NO4/c1-13-7-6-12-18(13,17(21)22-2)16(20)11-10-15(19)14-8-4-3-5-9-14/h3-5,8-9,13H,6-7,10-12H2,1-2H3/q+1/t13-,18?/m1/s1 |
| InChIKey | HRNXBKMCAGXJOM-YJJYDOSJSA-N |
| XLogP | 2.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|