C13H16NO4+ — CID 91805895
(2R)-2-methyl-1-phenoxycarbonylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 91805895) has the molecular formula C13H16NO4+ and a molecular weight of 250.27 g/mol. Its IUPAC name is (2R)-2-methyl-1-phenoxycarbonylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-phenoxycarbonylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 91805895 |
| Molecular Formula | C13H16NO4+ |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R)-2-methyl-1-phenoxycarbonylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H15NO4/c1-10-6-5-9-14(10,12(15)16)13(17)18-11-7-3-2-4-8-11/h2-4,7-8,10H,5-6,9H2,1H3/p+1/t10-,14?/m1/s1 |
| InChIKey | BGNUXHVMUWNQQW-IAPIXIRKSA-O |
| XLogP | 2.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|