C21H28NO4S+ — CID 57237643
(2R)-1-(2-benzoylsulfanyl-3,3-dimethylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57237643) has the molecular formula C21H28NO4S+ and a molecular weight of 390.53 g/mol. Its IUPAC name is (2R)-1-(2-benzoylsulfanyl-3,3-dimethylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(2-benzoylsulfanyl-3,3-dimethylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57237643 |
| Molecular Formula | C21H28NO4S+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2R)-1-(2-benzoylsulfanyl-3,3-dimethylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C1CCC(C)(C)C1SC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO4S/c1-14-8-7-13-22(14,20(25)26)18(23)16-11-12-21(2,3)17(16)27-19(24)15-9-5-4-6-10-15/h4-6,9-10,14,16-17H,7-8,11-13H2,1-3H3/p+1/t14-,16?,17?,22?/m1/s1 |
| InChIKey | RLIOKUFADARRIG-XHZFVRRNSA-O |
| XLogP | 4.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|