C27H25ClN3O5S+ — CID 57223419
(2R)-1-[3-(5-benzoylpyrimidin-2-yl)sulfanyl-4-(4-chlorophenyl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57223419) has the molecular formula C27H25ClN3O5S+ and a molecular weight of 539.03 g/mol. Its IUPAC name is (2R)-1-[3-(5-benzoylpyrimidin-2-yl)sulfanyl-4-(4-chlorophenyl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[3-(5-benzoylpyrimidin-2-yl)sulfanyl-4-(4-chlorophenyl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57223419 |
| Molecular Formula | C27H25ClN3O5S+ |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | (2R)-1-[3-(5-benzoylpyrimidin-2-yl)sulfanyl-4-(4-chlorophenyl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)CC(Sc1ncc(C(=O)c2ccccc2)cn1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24ClN3O5S/c1-17-6-5-13-31(17,27(35)36)23(32)14-22(25(34)19-9-11-21(28)12-10-19)37-26-29-15-20(16-30-26)24(33)18-7-3-2-4-8-18/h2-4,7-12,15-17,22H,5-6,13-14H2,1H3/p+1/t17-,22?,31?/m1/s1 |
| InChIKey | CWFFTUGFKIDBSV-SOTKQGRLSA-O |
| XLogP | 5.30 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|