C17H20BrFNO4+ — CID 57042630
(2R)-1-[3-bromo-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57042630) has the molecular formula C17H20BrFNO4+ and a molecular weight of 401.25 g/mol. Its IUPAC name is (2R)-1-[3-bromo-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[3-bromo-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57042630 |
| Molecular Formula | C17H20BrFNO4+ |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (2R)-1-[3-bromo-4-(3-fluorophenyl)-2-methyl-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(C(=O)[N+]1(C(=O)O)CCC[C@H]1C)C(Br)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H19BrFNO4/c1-10-5-4-8-20(10,17(23)24)16(22)11(2)14(18)15(21)12-6-3-7-13(19)9-12/h3,6-7,9-11,14H,4-5,8H2,1-2H3/p+1/t10-,11?,14?,20?/m1/s1 |
| InChIKey | XUUWEIKPVOFNQB-JNVDAYTRSA-O |
| XLogP | 3.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|