C15H19N2O4+ — CID 56995579
(2R)-2-methyl-1-(4-oxo-4-pyridin-3-ylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56995579) has the molecular formula C15H19N2O4+ and a molecular weight of 291.33 g/mol. Its IUPAC name is (2R)-2-methyl-1-(4-oxo-4-pyridin-3-ylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-(4-oxo-4-pyridin-3-ylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56995579 |
| Molecular Formula | C15H19N2O4+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2R)-2-methyl-1-(4-oxo-4-pyridin-3-ylbutanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)CCC(=O)c1cccnc1 |
| InChI | InChI=1S/C15H18N2O4/c1-11-4-3-9-17(11,15(20)21)14(19)7-6-13(18)12-5-2-8-16-10-12/h2,5,8,10-11H,3-4,6-7,9H2,1H3/p+1/t11-,17?/m1/s1 |
| InChIKey | AZTOXXJDJKFAAW-VCQTYVLVSA-O |
| XLogP | 2.25 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|