C14H18N2O3 — CID 110631390
1-(2-methylmorpholin-4-yl)-4-pyridin-3-ylbutane-1,4-dione (PubChem CID 110631390) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-(2-methylmorpholin-4-yl)-4-pyridin-3-ylbutane-1,4-dione.
| Compound Name | 1-(2-methylmorpholin-4-yl)-4-pyridin-3-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 110631390 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(2-methylmorpholin-4-yl)-4-pyridin-3-ylbutane-1,4-dione |
| SMILES | CC1CN(C(=O)CCC(=O)c2cccnc2)CCO1 |
| InChI | InChI=1S/C14H18N2O3/c1-11-10-16(7-8-19-11)14(18)5-4-13(17)12-3-2-6-15-9-12/h2-3,6,9,11H,4-5,7-8,10H2,1H3 |
| InChIKey | AKWDIQHUEAMKES-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |