C14H24NO3S+ — CID 57230968
(2R)-1-(1-ethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57230968) has the molecular formula C14H24NO3S+ and a molecular weight of 286.42 g/mol. Its IUPAC name is (2R)-1-(1-ethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(1-ethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57230968 |
| Molecular Formula | C14H24NO3S+ |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (2R)-1-(1-ethyl-2-sulfanylcyclopentanecarbonyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCC1(C(=O)[N+]2(C(=O)O)CCC[C@H]2C)CCCC1S |
| InChI | InChI=1S/C14H23NO3S/c1-3-14(8-4-7-11(14)19)12(16)15(13(17)18)9-5-6-10(15)2/h10-11H,3-9H2,1-2H3,(H-,17,18,19)/p+1/t10-,11?,14?,15?/m1/s1 |
| InChIKey | MGIFKSIJLPKCOH-AHNOMFPFSA-O |
| XLogP | 3.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|