C21H26N2O4P+ — CID 56617842
(2R)-1-[(2S)-2-(diphenylphosphorylamino)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 56617842) has the molecular formula C21H26N2O4P+ and a molecular weight of 401.42 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-(diphenylphosphorylamino)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-(diphenylphosphorylamino)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 56617842 |
| Molecular Formula | C21H26N2O4P+ |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2R)-1-[(2S)-2-(diphenylphosphorylamino)propanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@H](NP(=O)(c1ccccc1)c1ccccc1)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C21H25N2O4P/c1-16-10-9-15-23(16,21(25)26)20(24)17(2)22-28(27,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,16-17H,9-10,15H2,1-2H3,(H-,22,25,26,27)/p+1/t16-,17+,23?/m1/s1 |
| InChIKey | NAMDFCSOOMRJLL-RQJVYDMZSA-O |
| XLogP | 3.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|