C28H32NO4P — CID 102187904
(2R,3R)-3-cyclohexyl-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one (PubChem CID 102187904) has the molecular formula C28H32NO4P and a molecular weight of 477.54 g/mol. Its IUPAC name is (2R,3R)-3-cyclohexyl-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one.
| Compound Name | (2R,3R)-3-cyclohexyl-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 102187904 |
| Molecular Formula | C28H32NO4P |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (2R,3R)-3-cyclohexyl-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one |
| SMILES | COc1ccccc1C(=O)[C@H](O)[C@H](NP(=O)(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C28H32NO4P/c1-33-25-20-12-11-19-24(25)27(30)28(31)26(21-13-5-2-6-14-21)29-34(32,22-15-7-3-8-16-22)23-17-9-4-10-18-23/h3-4,7-12,15-21,26,28,31H,2,5-6,13-14H2,1H3,(H,29,32)/t26-,28-/m1/s1 |
| InChIKey | XGVNIMZPLGTXKN-IXCJQBJRSA-N |
| XLogP | 4.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|