C24H30NO3P — CID 102044114
methyl (3R)-4-cyclohexyl-3-(diphenylphosphorylamino)-2-methylidenebutanoate (PubChem CID 102044114) has the molecular formula C24H30NO3P and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl (3R)-4-cyclohexyl-3-(diphenylphosphorylamino)-2-methylidenebutanoate.
| Compound Name | methyl (3R)-4-cyclohexyl-3-(diphenylphosphorylamino)-2-methylidenebutanoate |
|---|---|
| PubChem CID | 102044114 |
| Molecular Formula | C24H30NO3P |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | methyl (3R)-4-cyclohexyl-3-(diphenylphosphorylamino)-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](CC1CCCCC1)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30NO3P/c1-19(24(26)28-2)23(18-20-12-6-3-7-13-20)25-29(27,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h4-5,8-11,14-17,20,23H,1,3,6-7,12-13,18H2,2H3,(H,25,27)/t23-/m1/s1 |
| InChIKey | GFUVWVMZZIIGDC-HSZRJFAPSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|