C29H34NO4P — CID 70082757
[(3S)-4-cyclohexyl-2-oxo-3-(tritylamino)butyl]phosphonic acid (PubChem CID 70082757) has the molecular formula C29H34NO4P and a molecular weight of 491.57 g/mol. Its IUPAC name is [(3S)-4-cyclohexyl-2-oxo-3-(tritylamino)butyl]phosphonic acid.
| Compound Name | [(3S)-4-cyclohexyl-2-oxo-3-(tritylamino)butyl]phosphonic acid |
|---|---|
| PubChem CID | 70082757 |
| Molecular Formula | C29H34NO4P |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [(3S)-4-cyclohexyl-2-oxo-3-(tritylamino)butyl]phosphonic acid |
| SMILES | O=C(CP(=O)(O)O)[C@H](CC1CCCCC1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34NO4P/c31-28(22-35(32,33)34)27(21-23-13-5-1-6-14-23)30-29(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h2-4,7-12,15-20,23,27,30H,1,5-6,13-14,21-22H2,(H2,32,33,34)/t27-/m0/s1 |
| InChIKey | AMTBIQRUEJDBQO-MHZLTWQESA-N |
| XLogP | 5.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|