C23H32NOP — CID 134983888
(2S)-1-cyclopentyl-N-diphenylphosphorylhexan-2-amine (PubChem CID 134983888) has the molecular formula C23H32NOP and a molecular weight of 369.49 g/mol. Its IUPAC name is (2S)-1-cyclopentyl-N-diphenylphosphorylhexan-2-amine.
| Compound Name | (2S)-1-cyclopentyl-N-diphenylphosphorylhexan-2-amine |
|---|---|
| PubChem CID | 134983888 |
| Molecular Formula | C23H32NOP |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (2S)-1-cyclopentyl-N-diphenylphosphorylhexan-2-amine |
| SMILES | CCCC[C@@H](CC1CCCC1)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32NOP/c1-2-3-14-21(19-20-12-10-11-13-20)24-26(25,22-15-6-4-7-16-22)23-17-8-5-9-18-23/h4-9,15-18,20-21H,2-3,10-14,19H2,1H3,(H,24,25)/t21-/m0/s1 |
| InChIKey | CKFKRPFDEZKMEJ-NRFANRHFSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|