C28H36NOP — CID 134927465
(5S)-N-diphenylphosphoryl-8-methyl-1-phenylnonan-5-amine (PubChem CID 134927465) has the molecular formula C28H36NOP and a molecular weight of 433.58 g/mol. Its IUPAC name is (5S)-N-diphenylphosphoryl-8-methyl-1-phenylnonan-5-amine.
| Compound Name | (5S)-N-diphenylphosphoryl-8-methyl-1-phenylnonan-5-amine |
|---|---|
| PubChem CID | 134927465 |
| Molecular Formula | C28H36NOP |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (5S)-N-diphenylphosphoryl-8-methyl-1-phenylnonan-5-amine |
| SMILES | CC(C)CC[C@H](CCCCc1ccccc1)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36NOP/c1-24(2)22-23-26(17-13-12-16-25-14-6-3-7-15-25)29-31(30,27-18-8-4-9-19-27)28-20-10-5-11-21-28/h3-11,14-15,18-21,24,26H,12-13,16-17,22-23H2,1-2H3,(H,29,30)/t26-/m0/s1 |
| InChIKey | LVSTZUSHGPTRES-SANMLTNESA-N |
| XLogP | 6.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|