C28H25BrNO4P — CID 101242769
(2R,3R)-3-(4-bromophenyl)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one (PubChem CID 101242769) has the molecular formula C28H25BrNO4P and a molecular weight of 550.39 g/mol. Its IUPAC name is (2R,3R)-3-(4-bromophenyl)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one.
| Compound Name | (2R,3R)-3-(4-bromophenyl)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 101242769 |
| Molecular Formula | C28H25BrNO4P |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | (2R,3R)-3-(4-bromophenyl)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)propan-1-one |
| SMILES | COc1ccccc1C(=O)[C@H](O)[C@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H25BrNO4P/c1-34-25-15-9-8-14-24(25)27(31)28(32)26(20-16-18-21(29)19-17-20)30-35(33,22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-19,26,28,32H,1H3,(H,30,33)/t26-,28-/m1/s1 |
| InChIKey | CPDLXPIBWMYJID-IXCJQBJRSA-N |
| XLogP | 5.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|