C26H28NO4P — CID 102187891
(2R,3S)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)hept-6-en-1-one (PubChem CID 102187891) has the molecular formula C26H28NO4P and a molecular weight of 449.49 g/mol. Its IUPAC name is (2R,3S)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)hept-6-en-1-one.
| Compound Name | (2R,3S)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)hept-6-en-1-one |
|---|---|
| PubChem CID | 102187891 |
| Molecular Formula | C26H28NO4P |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (2R,3S)-3-(diphenylphosphorylamino)-2-hydroxy-1-(2-methoxyphenyl)hept-6-en-1-one |
| SMILES | C=CCC[C@H](NP(=O)(c1ccccc1)c1ccccc1)[C@@H](O)C(=O)c1ccccc1OC |
| InChI | InChI=1S/C26H28NO4P/c1-3-4-18-23(26(29)25(28)22-17-11-12-19-24(22)31-2)27-32(30,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h3,5-17,19,23,26,29H,1,4,18H2,2H3,(H,27,30)/t23-,26+/m0/s1 |
| InChIKey | SLSQMVLOBQLUGN-JYFHCDHNSA-N |
| XLogP | 4.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|