About S-(tetrazolidin-5-yl) benzenecarbothioate
S-(tetrazolidin-5-yl) benzenecarbothioate (PubChem CID 134098672) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is S-(tetrazolidin-5-yl) benzenecarbothioate.
Molecular Properties
| Compound Name | S-(tetrazolidin-5-yl) benzenecarbothioate |
| PubChem CID | 134098672 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | S-(tetrazolidin-5-yl) benzenecarbothioate |
| SMILES | O=C(SC1NNNN1)c1ccccc1 |
| InChI | InChI=1S/C8H10N4OS/c13-7(6-4-2-1-3-5-6)14-8-9-11-12-10-8/h1-5,8-12H |
| InChIKey | WQNKAXUZBFPFMI-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(tetrazolidin-5-yl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(tetrazolidin-5-yl) benzenecarbothioate?
The IUPAC name of S-(tetrazolidin-5-yl) benzenecarbothioate (CID 134098672) is S-(tetrazolidin-5-yl) benzenecarbothioate.
What is the SMILES notation for S-(tetrazolidin-5-yl) benzenecarbothioate?
The canonical SMILES for S-(tetrazolidin-5-yl) benzenecarbothioate is O=C(SC1NNNN1)c1ccccc1.
What is the InChIKey of S-(tetrazolidin-5-yl) benzenecarbothioate?
The InChIKey is WQNKAXUZBFPFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c13-7(6-4-2-1-3-5-6)14-8-9-11-12-10-8/h1-5,8-12H.
What are the key properties of S-(tetrazolidin-5-yl) benzenecarbothioate?
S-(tetrazolidin-5-yl) benzenecarbothioate has a molecular weight of 210.26 g/mol, XLogP of -0.04, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(tetrazolidin-5-yl) benzenecarbothioate is sourced from PubChem (CID 134098672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).