C14H18NO5+ — CID 57267776
(2R)-1-[4-(furan-2-yl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57267776) has the molecular formula C14H18NO5+ and a molecular weight of 280.30 g/mol. Its IUPAC name is (2R)-1-[4-(furan-2-yl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[4-(furan-2-yl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57267776 |
| Molecular Formula | C14H18NO5+ |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2R)-1-[4-(furan-2-yl)-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)CCC(=O)c1ccco1 |
| InChI | InChI=1S/C14H17NO5/c1-10-4-2-8-15(10,14(18)19)13(17)7-6-11(16)12-5-3-9-20-12/h3,5,9-10H,2,4,6-8H2,1H3/p+1/t10-,15?/m1/s1 |
| InChIKey | XQWGWEWWRIFABP-INHVJJQHSA-O |
| XLogP | 2.45 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|