C24H37NO7P+ — CID 57297749
[2-[(1S,2R)-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid (PubChem CID 57297749) has the molecular formula C24H37NO7P+ and a molecular weight of 482.53 g/mol. Its IUPAC name is [2-[(1S,2R)-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid.
| Compound Name | [2-[(1S,2R)-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 57297749 |
| Molecular Formula | C24H37NO7P+ |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [2-[(1S,2R)-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid |
| SMILES | C[C@@H]1CCC[N@+]1(C(=O)CP(=O)(O)CCCCc1ccccc1)C(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H36NO7P/c1-19-11-10-15-25(19,23(28)32-18-31-22(27)24(2,3)4)21(26)17-33(29,30)16-9-8-14-20-12-6-5-7-13-20/h5-7,12-13,19H,8-11,14-18H2,1-4H3/p+1/t19-,25+/m1/s1 |
| InChIKey | IUZFSBGGWHXJQD-CLOONOSVSA-O |
| XLogP | 4.49 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|