C30H47NO7P+ — CID 57014661
[2-[(1R,2R,4S)-4-cyclohexyl-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid (PubChem CID 57014661) has the molecular formula C30H47NO7P+ and a molecular weight of 564.68 g/mol. Its IUPAC name is [2-[(1R,2R,4S)-4-cyclohexyl-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid.
| Compound Name | [2-[(1R,2R,4S)-4-cyclohexyl-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 57014661 |
| Molecular Formula | C30H47NO7P+ |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | [2-[(1R,2R,4S)-4-cyclohexyl-1-(2,2-dimethylpropanoyloxymethoxycarbonyl)-2-methylpyrrolidin-1-ium-1-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid |
| SMILES | C[C@@H]1C[C@@H](C2CCCCC2)C[N@@+]1(C(=O)CP(=O)(O)CCCCc1ccccc1)C(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H46NO7P/c1-23-19-26(25-16-9-6-10-17-25)20-31(23,29(34)38-22-37-28(33)30(2,3)4)27(32)21-39(35,36)18-12-11-15-24-13-7-5-8-14-24/h5,7-8,13-14,23,25-26H,6,9-12,15-22H2,1-4H3/p+1/t23-,26-,31-/m1/s1 |
| InChIKey | GSPZPLNZQZKRFH-WCUJTLSMSA-O |
| XLogP | 6.30 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|