C24H35O5P — CID 23541232
4-cyclohexyl-2-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]cyclopentane-1-carboxylic acid (PubChem CID 23541232) has the molecular formula C24H35O5P and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-cyclohexyl-2-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]cyclopentane-1-carboxylic acid.
| Compound Name | 4-cyclohexyl-2-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 23541232 |
| Molecular Formula | C24H35O5P |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-cyclohexyl-2-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(C2CCCCC2)CC1C(=O)CP(=O)(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C24H35O5P/c25-23(17-30(28,29)14-8-7-11-18-9-3-1-4-10-18)21-15-20(16-22(21)24(26)27)19-12-5-2-6-13-19/h1,3-4,9-10,19-22H,2,5-8,11-17H2,(H,26,27)(H,28,29) |
| InChIKey | YVNFESQCEUGIMK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|