C24H36N2O7P+ — CID 70076228
[[1-(carboxymethyl)-2-oxoazepan-3-yl]amino]-[(1S)-1-(2,2-dimethylpropanoyloxymethoxy)-4-phenylbutyl]-oxophosphanium (PubChem CID 70076228) has the molecular formula C24H36N2O7P+ and a molecular weight of 495.53 g/mol. Its IUPAC name is [[1-(carboxymethyl)-2-oxoazepan-3-yl]amino]-[(1S)-1-(2,2-dimethylpropanoyloxymethoxy)-4-phenylbutyl]-oxophosphanium.
| Compound Name | [[1-(carboxymethyl)-2-oxoazepan-3-yl]amino]-[(1S)-1-(2,2-dimethylpropanoyloxymethoxy)-4-phenylbutyl]-oxophosphanium |
|---|---|
| PubChem CID | 70076228 |
| Molecular Formula | C24H36N2O7P+ |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [[1-(carboxymethyl)-2-oxoazepan-3-yl]amino]-[(1S)-1-(2,2-dimethylpropanoyloxymethoxy)-4-phenylbutyl]-oxophosphanium |
| SMILES | CC(C)(C)C(=O)OCO[C@H](CCCc1ccccc1)[P+](=O)NC1CCCCN(CC(=O)O)C1=O |
| InChI | InChI=1S/C24H35N2O7P/c1-24(2,3)23(30)33-17-32-21(14-9-12-18-10-5-4-6-11-18)34(31)25-19-13-7-8-15-26(22(19)29)16-20(27)28/h4-6,10-11,19,21H,7-9,12-17H2,1-3H3,(H-,25,27,28,31)/p+1/t19?,21-/m0/s1 |
| InChIKey | QMPDXCPDGIRDRG-QWAKEFERSA-O |
| XLogP | 3.70 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|