C20H31N2O5P — CID 54288376
2-[(3S)-3-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-2-oxoazepan-1-yl]acetic acid (PubChem CID 54288376) has the molecular formula C20H31N2O5P and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[(3S)-3-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-2-oxoazepan-1-yl]acetic acid.
| Compound Name | 2-[(3S)-3-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-2-oxoazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 54288376 |
| Molecular Formula | C20H31N2O5P |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[(3S)-3-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-2-oxoazepan-1-yl]acetic acid |
| SMILES | CCOP(=O)(CCCCc1ccccc1)N[C@H]1CCCCN(CC(=O)O)C1=O |
| InChI | InChI=1S/C20H31N2O5P/c1-2-27-28(26,15-9-7-12-17-10-4-3-5-11-17)21-18-13-6-8-14-22(20(18)25)16-19(23)24/h3-5,10-11,18H,2,6-9,12-16H2,1H3,(H,21,26)(H,23,24)/t18-,28?/m0/s1 |
| InChIKey | RVTSBHPCWWOSRV-BVFFRPSBSA-N |
| XLogP | 3.29 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|