C29H43N2O5PSSi — CID 86739557
2-trimethylsilylethyl 2-[(2R)-5-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetate (PubChem CID 86739557) has the molecular formula C29H43N2O5PSSi and a molecular weight of 590.80 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(2R)-5-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetate.
| Compound Name | 2-trimethylsilylethyl 2-[(2R)-5-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetate |
|---|---|
| PubChem CID | 86739557 |
| Molecular Formula | C29H43N2O5PSSi |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(2R)-5-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazinan-3-yl]acetate |
| SMILES | CCOP(=O)(CCCCc1ccccc1)NC1CS[C@H](c2ccccc2)N(CC(=O)OCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C29H43N2O5PSSi/c1-5-36-37(34,20-13-12-16-24-14-8-6-9-15-24)30-26-23-38-29(25-17-10-7-11-18-25)31(28(26)33)22-27(32)35-19-21-39(2,3)4/h6-11,14-15,17-18,26,29H,5,12-13,16,19-23H2,1-4H3,(H,30,34)/t26?,29-,37?/m1/s1 |
| InChIKey | PHXVUPBSTVIKEU-FHIIWLJPSA-N |
| XLogP | 6.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|