C34H42N3O5P — CID 22838114
benzyl (4S,7S)-6-oxo-7-[[4-phenylbutyl(phenylmethoxy)phosphoryl]amino]-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 22838114) has the molecular formula C34H42N3O5P and a molecular weight of 603.70 g/mol. Its IUPAC name is benzyl (4S,7S)-6-oxo-7-[[4-phenylbutyl(phenylmethoxy)phosphoryl]amino]-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | benzyl (4S,7S)-6-oxo-7-[[4-phenylbutyl(phenylmethoxy)phosphoryl]amino]-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 22838114 |
| Molecular Formula | C34H42N3O5P |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | benzyl (4S,7S)-6-oxo-7-[[4-phenylbutyl(phenylmethoxy)phosphoryl]amino]-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCN2CCC[C@H](NP(=O)(CCCCc3ccccc3)OCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C34H42N3O5P/c38-33-31(21-12-23-36-24-13-22-32(37(33)36)34(39)41-26-29-17-6-2-7-18-29)35-43(40,42-27-30-19-8-3-9-20-30)25-11-10-16-28-14-4-1-5-15-28/h1-9,14-15,17-20,31-32H,10-13,16,21-27H2,(H,35,40)/t31-,32-,43?/m0/s1 |
| InChIKey | MYDDMHYDGMBPOK-VNKWJHHISA-N |
| XLogP | 6.12 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|