C29H30N2O5 — CID 118235232
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 2-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetate (PubChem CID 118235232) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 2-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 2-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 118235232 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 2-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]acetate |
| SMILES | O=C(Cc1ccc(CCCCc2ccccc2)cc1)NOC(=O)CN1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H30N2O5/c32-27(19-24-17-15-23(16-18-24)12-8-7-11-22-9-3-1-4-10-22)30-36-28(33)20-31-26(21-35-29(31)34)25-13-5-2-6-14-25/h1-6,9-10,13-18,26H,7-8,11-12,19-21H2,(H,30,32)/t26-/m1/s1 |
| InChIKey | ZQUGNNDWJSCNCU-AREMUKBSSA-N |
| XLogP | 4.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|