C21H35N2O5P — CID 22859648
methyl 3-[[(2S)-2-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-3-methylbutanoyl]amino]propanoate (PubChem CID 22859648) has the molecular formula C21H35N2O5P and a molecular weight of 426.49 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-3-methylbutanoyl]amino]propanoate.
| Compound Name | methyl 3-[[(2S)-2-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-3-methylbutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 22859648 |
| Molecular Formula | C21H35N2O5P |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | methyl 3-[[(2S)-2-[[ethoxy(4-phenylbutyl)phosphoryl]amino]-3-methylbutanoyl]amino]propanoate |
| SMILES | CCOP(=O)(CCCCc1ccccc1)N[C@H](C(=O)NCCC(=O)OC)C(C)C |
| InChI | InChI=1S/C21H35N2O5P/c1-5-28-29(26,16-10-9-13-18-11-7-6-8-12-18)23-20(17(2)3)21(25)22-15-14-19(24)27-4/h6-8,11-12,17,20H,5,9-10,13-16H2,1-4H3,(H,22,25)(H,23,26)/t20-,29?/m0/s1 |
| InChIKey | UHWXFYCOPRPLMZ-OORIHMLWSA-N |
| XLogP | 3.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|