C16H14N2O — CID 100991676
N-(2-pyrrol-1-ylphenyl)cyclopenta-2,4-diene-1-carboxamide (PubChem CID 100991676) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(2-pyrrol-1-ylphenyl)cyclopenta-2,4-diene-1-carboxamide.
| Compound Name | N-(2-pyrrol-1-ylphenyl)cyclopenta-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 100991676 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(2-pyrrol-1-ylphenyl)cyclopenta-2,4-diene-1-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1cccc1)C1C=CC=C1 |
| InChI | InChI=1S/C16H14N2O/c19-16(13-7-1-2-8-13)17-14-9-3-4-10-15(14)18-11-5-6-12-18/h1-13H,(H,17,19) |
| InChIKey | NOSJKNNYJDAQHA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |