About 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide
1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 22223644) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide |
| PubChem CID | 22223644 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)Nc1ccccc1-n1cccc1 |
| InChI | InChI=1S/C16H18N4O2/c17-15(21)14-8-5-11-20(14)16(22)18-12-6-1-2-7-13(12)19-9-3-4-10-19/h1-4,6-7,9-10,14H,5,8,11H2,(H2,17,21)(H,18,22) |
| InChIKey | HXWNVTGLVCFMMG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide?
The IUPAC name of 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide (CID 22223644) is 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide.
What is the SMILES notation for 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide?
The canonical SMILES for 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide is NC(=O)C1CCCN1C(=O)Nc1ccccc1-n1cccc1.
What is the InChIKey of 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide?
The InChIKey is HXWNVTGLVCFMMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c17-15(21)14-8-5-11-20(14)16(22)18-12-6-1-2-7-13(12)19-9-3-4-10-19/h1-4,6-7,9-10,14H,5,8,11H2,(H2,17,21)(H,18,22).
What are the key properties of 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide?
1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide has a molecular weight of 298.35 g/mol, XLogP of 1.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(2-pyrrol-1-ylphenyl)pyrrolidine-1,2-dicarboxamide is sourced from PubChem (CID 22223644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).