C16H21N3O2 — CID 95051482
(2R)-2-N-cyclopropyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 95051482) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2R)-2-N-cyclopropyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-cyclopropyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 95051482 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2R)-2-N-cyclopropyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)N1CCC[C@@H]1C(=O)NC1CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-11-5-2-3-6-13(11)18-16(21)19-10-4-7-14(19)15(20)17-12-8-9-12/h2-3,5-6,12,14H,4,7-10H2,1H3,(H,17,20)(H,18,21)/t14-/m1/s1 |
| InChIKey | MUYBUVQFEVRHIW-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |