C17H25N3O2 — CID 3230177
2-N-tert-butyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 3230177) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-N-tert-butyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-tert-butyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3230177 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-N-tert-butyl-1-N-(2-methylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)N1CCCC1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H25N3O2/c1-12-8-5-6-9-13(12)18-16(22)20-11-7-10-14(20)15(21)19-17(2,3)4/h5-6,8-9,14H,7,10-11H2,1-4H3,(H,18,22)(H,19,21) |
| InChIKey | IIFWTQASHKLOGA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |