C13H16FN3OS — CID 8675880
(2R)-1-[(2-fluorophenyl)carbamothioyl]piperidine-2-carboxamide (PubChem CID 8675880) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)carbamothioyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-[(2-fluorophenyl)carbamothioyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 8675880 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)carbamothioyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCN1C(=S)Nc1ccccc1F |
| InChI | InChI=1S/C13H16FN3OS/c14-9-5-1-2-6-10(9)16-13(19)17-8-4-3-7-11(17)12(15)18/h1-2,5-6,11H,3-4,7-8H2,(H2,15,18)(H,16,19)/t11-/m1/s1 |
| InChIKey | YTRCPGRGDPXALX-LLVKDONJSA-N |
| XLogP | 1.86 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|