C15H21N3OS — CID 8628848
(2S)-1-[(3,5-dimethylphenyl)carbamothioyl]piperidine-2-carboxamide (PubChem CID 8628848) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is (2S)-1-[(3,5-dimethylphenyl)carbamothioyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[(3,5-dimethylphenyl)carbamothioyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 8628848 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2S)-1-[(3,5-dimethylphenyl)carbamothioyl]piperidine-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCCC[C@H]2C(N)=O)c1 |
| InChI | InChI=1S/C15H21N3OS/c1-10-7-11(2)9-12(8-10)17-15(20)18-6-4-3-5-13(18)14(16)19/h7-9,13H,3-6H2,1-2H3,(H2,16,19)(H,17,20)/t13-/m0/s1 |
| InChIKey | TYYLFLHEIGWZID-ZDUSSCGKSA-N |
| XLogP | 2.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|