C13H17N3O4S — CID 118772011
(2R)-1-N-(4-methylsulfonylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 118772011) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2R)-1-N-(4-methylsulfonylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(4-methylsulfonylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 118772011 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2R)-1-N-(4-methylsulfonylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C13H17N3O4S/c1-21(19,20)10-6-4-9(5-7-10)15-13(18)16-8-2-3-11(16)12(14)17/h4-7,11H,2-3,8H2,1H3,(H2,14,17)(H,15,18)/t11-/m1/s1 |
| InChIKey | GMOHNFDFNBDCCQ-LLVKDONJSA-N |
| XLogP | 0.57 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |