C17H22N2O4S — CID 118765159
(2R)-1-[1-(4-methylsulfonylphenyl)cyclobutanecarbonyl]pyrrolidine-2-carboxamide (PubChem CID 118765159) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (2R)-1-[1-(4-methylsulfonylphenyl)cyclobutanecarbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[1-(4-methylsulfonylphenyl)cyclobutanecarbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118765159 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2R)-1-[1-(4-methylsulfonylphenyl)cyclobutanecarbonyl]pyrrolidine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C2(C(=O)N3CCC[C@@H]3C(N)=O)CCC2)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-24(22,23)13-7-5-12(6-8-13)17(9-3-10-17)16(21)19-11-2-4-14(19)15(18)20/h5-8,14H,2-4,9-11H2,1H3,(H2,18,20)/t14-/m1/s1 |
| InChIKey | VSUQUYWMMSZYOU-CQSZACIVSA-N |
| XLogP | 0.99 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |