C16H18FNO3 — CID 43423447
methyl 1-[1-(4-fluorophenyl)cyclopropanecarbonyl]pyrrolidine-2-carboxylate (PubChem CID 43423447) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is methyl 1-[1-(4-fluorophenyl)cyclopropanecarbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[1-(4-fluorophenyl)cyclopropanecarbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43423447 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | methyl 1-[1-(4-fluorophenyl)cyclopropanecarbonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)C1(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H18FNO3/c1-21-14(19)13-3-2-10-18(13)15(20)16(8-9-16)11-4-6-12(17)7-5-11/h4-7,13H,2-3,8-10H2,1H3 |
| InChIKey | RXRWIBYKCUBUHC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |