C19H28N2O3S — CID 118788762
N-methyl-N-(1-methylpiperidin-4-yl)-1-(4-methylsulfonylphenyl)cyclobutane-1-carboxamide (PubChem CID 118788762) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-methyl-N-(1-methylpiperidin-4-yl)-1-(4-methylsulfonylphenyl)cyclobutane-1-carboxamide.
| Compound Name | N-methyl-N-(1-methylpiperidin-4-yl)-1-(4-methylsulfonylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 118788762 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-methyl-N-(1-methylpiperidin-4-yl)-1-(4-methylsulfonylphenyl)cyclobutane-1-carboxamide |
| SMILES | CN1CCC(N(C)C(=O)C2(c3ccc(S(C)(=O)=O)cc3)CCC2)CC1 |
| InChI | InChI=1S/C19H28N2O3S/c1-20-13-9-16(10-14-20)21(2)18(22)19(11-4-12-19)15-5-7-17(8-6-15)25(3,23)24/h5-8,16H,4,9-14H2,1-3H3 |
| InChIKey | YZCFWXWGTZRSIG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |