C20H29NO3S — CID 91793765
[1-(4-methylsulfonylphenyl)cyclobutyl]-(3-propan-2-ylpiperidin-1-yl)methanone (PubChem CID 91793765) has the molecular formula C20H29NO3S and a molecular weight of 363.52 g/mol. Its IUPAC name is [1-(4-methylsulfonylphenyl)cyclobutyl]-(3-propan-2-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(4-methylsulfonylphenyl)cyclobutyl]-(3-propan-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 91793765 |
| Molecular Formula | C20H29NO3S |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [1-(4-methylsulfonylphenyl)cyclobutyl]-(3-propan-2-ylpiperidin-1-yl)methanone |
| SMILES | CC(C)C1CCCN(C(=O)C2(c3ccc(S(C)(=O)=O)cc3)CCC2)C1 |
| InChI | InChI=1S/C20H29NO3S/c1-15(2)16-6-4-13-21(14-16)19(22)20(11-5-12-20)17-7-9-18(10-8-17)25(3,23)24/h7-10,15-16H,4-6,11-14H2,1-3H3 |
| InChIKey | HZDRUFZGZBPTLS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |