C19H28Cl2N2O — CID 119596142
[3-(1-aminoethyl)piperidin-1-yl]-[1-(3-chlorophenyl)cyclopentyl]methanone;hydrochloride (PubChem CID 119596142) has the molecular formula C19H28Cl2N2O and a molecular weight of 371.35 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[1-(3-chlorophenyl)cyclopentyl]methanone;hydrochloride.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[1-(3-chlorophenyl)cyclopentyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119596142 |
| Molecular Formula | C19H28Cl2N2O |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[1-(3-chlorophenyl)cyclopentyl]methanone;hydrochloride |
| SMILES | CC(N)C1CCCN(C(=O)C2(c3cccc(Cl)c3)CCCC2)C1.Cl |
| InChI | InChI=1S/C19H27ClN2O.ClH/c1-14(21)15-6-5-11-22(13-15)18(23)19(9-2-3-10-19)16-7-4-8-17(20)12-16;/h4,7-8,12,14-15H,2-3,5-6,9-11,13,21H2,1H3;1H |
| InChIKey | PMZFAOAROUVSKO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |