C25H27N6O2+ — CID 69060515
(2R)-1-[3-(1H-benzimidazol-2-yl)propanoyl]-2-methyl-N-(2-pyrazol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 69060515) has the molecular formula C25H27N6O2+ and a molecular weight of 443.53 g/mol. Its IUPAC name is (2R)-1-[3-(1H-benzimidazol-2-yl)propanoyl]-2-methyl-N-(2-pyrazol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[3-(1H-benzimidazol-2-yl)propanoyl]-2-methyl-N-(2-pyrazol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 69060515 |
| Molecular Formula | C25H27N6O2+ |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (2R)-1-[3-(1H-benzimidazol-2-yl)propanoyl]-2-methyl-N-(2-pyrazol-1-ylphenyl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)CCc1nc2ccccc2[nH]1)C(=O)Nc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C25H26N6O2/c1-18-8-6-17-31(18,24(32)14-13-23-27-19-9-2-3-10-20(19)28-23)25(33)29-21-11-4-5-12-22(21)30-16-7-15-26-30/h2-5,7,9-12,15-16,18H,6,8,13-14,17H2,1H3,(H-,27,28,29,33)/p+1/t18-,31?/m1/s1 |
| InChIKey | WJKVPMURTXKBIF-BPNQMYTISA-O |
| XLogP | 4.44 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|