C24H31NO4 — CID 10157665
4-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]butanoic acid (PubChem CID 10157665) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]butanoic acid.
| Compound Name | 4-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 10157665 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-[3-[4-(5-phenylpentoxy)phenyl]propanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCc1ccc(OCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO4/c26-23(25-18-7-11-24(27)28)17-14-21-12-15-22(16-13-21)29-19-6-2-5-10-20-8-3-1-4-9-20/h1,3-4,8-9,12-13,15-16H,2,5-7,10-11,14,17-19H2,(H,25,26)(H,27,28) |
| InChIKey | OVKSVHXYFMRRRP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|