C22H34NO2+ — CID 57189038
(2R)-2-methyl-1-(7-phenyl-2-propan-2-ylheptanoyl)pyrrolidin-1-ium-1-carbaldehyde (PubChem CID 57189038) has the molecular formula C22H34NO2+ and a molecular weight of 344.52 g/mol. Its IUPAC name is (2R)-2-methyl-1-(7-phenyl-2-propan-2-ylheptanoyl)pyrrolidin-1-ium-1-carbaldehyde.
| Compound Name | (2R)-2-methyl-1-(7-phenyl-2-propan-2-ylheptanoyl)pyrrolidin-1-ium-1-carbaldehyde |
|---|---|
| PubChem CID | 57189038 |
| Molecular Formula | C22H34NO2+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (2R)-2-methyl-1-(7-phenyl-2-propan-2-ylheptanoyl)pyrrolidin-1-ium-1-carbaldehyde |
| SMILES | CC(C)C(CCCCCc1ccccc1)C(=O)[N+]1(C=O)CCC[C@H]1C |
| InChI | InChI=1S/C22H34NO2/c1-18(2)21(22(25)23(17-24)16-10-11-19(23)3)15-9-5-8-14-20-12-6-4-7-13-20/h4,6-7,12-13,17-19,21H,5,8-11,14-16H2,1-3H3/q+1/t19-,21?,23?/m1/s1 |
| InChIKey | XYVDALAZIWECER-VWRAKTAISA-N |
| XLogP | 4.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|