C22H33NO4 — CID 70045519
2-hydroxy-2-[(2S)-1-[(2S)-7-phenyl-2-propan-2-ylheptanoyl]pyrrolidin-2-yl]acetic acid (PubChem CID 70045519) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-hydroxy-2-[(2S)-1-[(2S)-7-phenyl-2-propan-2-ylheptanoyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-hydroxy-2-[(2S)-1-[(2S)-7-phenyl-2-propan-2-ylheptanoyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 70045519 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 2-hydroxy-2-[(2S)-1-[(2S)-7-phenyl-2-propan-2-ylheptanoyl]pyrrolidin-2-yl]acetic acid |
| SMILES | CC(C)[C@H](CCCCCc1ccccc1)C(=O)N1CCC[C@H]1C(O)C(=O)O |
| InChI | InChI=1S/C22H33NO4/c1-16(2)18(13-8-4-7-12-17-10-5-3-6-11-17)21(25)23-15-9-14-19(23)20(24)22(26)27/h3,5-6,10-11,16,18-20,24H,4,7-9,12-15H2,1-2H3,(H,26,27)/t18-,19-,20?/m0/s1 |
| InChIKey | LLAJLNGHRNBZAU-NFBCFJMWSA-N |
| XLogP | 3.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|