C24H37NO5 — CID 57032935
ethyl 2-hydroxy-2-[1-[(2S)-6-(4-methoxyphenyl)-2-propan-2-ylhexanoyl]pyrrolidin-2-yl]acetate (PubChem CID 57032935) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-[1-[(2S)-6-(4-methoxyphenyl)-2-propan-2-ylhexanoyl]pyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-hydroxy-2-[1-[(2S)-6-(4-methoxyphenyl)-2-propan-2-ylhexanoyl]pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 57032935 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | ethyl 2-hydroxy-2-[1-[(2S)-6-(4-methoxyphenyl)-2-propan-2-ylhexanoyl]pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)C(O)C1CCCN1C(=O)[C@@H](CCCCc1ccc(OC)cc1)C(C)C |
| InChI | InChI=1S/C24H37NO5/c1-5-30-24(28)22(26)21-11-8-16-25(21)23(27)20(17(2)3)10-7-6-9-18-12-14-19(29-4)15-13-18/h12-15,17,20-22,26H,5-11,16H2,1-4H3/t20-,21?,22?/m0/s1 |
| InChIKey | XYOLELVCVKHEEW-HWELCPFYSA-N |
| XLogP | 3.60 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|